C25H25N5O2S2 — CID 24591946
N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide (PubChem CID 24591946) has the molecular formula C25H25N5O2S2 and a molecular weight of 491.64 g/mol. Its IUPAC name is N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide.
| Compound Name | N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
|---|---|
| PubChem CID | 24591946 |
| Molecular Formula | C25H25N5O2S2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
| SMILES | Cc1cc(C)nc(Sc2ccc(NC(=O)c3sc4nc5n(c(=O)c4c3C)CCCCC5)cc2)n1 |
| InChI | InChI=1S/C25H25N5O2S2/c1-14-13-15(2)27-25(26-14)33-18-10-8-17(9-11-18)28-22(31)21-16(3)20-23(34-21)29-19-7-5-4-6-12-30(19)24(20)32/h8-11,13H,4-7,12H2,1-3H3,(H,28,31) |
| InChIKey | ZIQHGZQQFAPXPI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |