C22H22N6O4S — CID 55457043
N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide (PubChem CID 55457043) has the molecular formula C22H22N6O4S and a molecular weight of 466.52 g/mol. Its IUPAC name is N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide.
| Compound Name | N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
|---|---|
| PubChem CID | 55457043 |
| Molecular Formula | C22H22N6O4S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cnc3c(c2)c(=O)n(C)c(=O)n3C)sc2nc3n(c(=O)c12)CCCCC3 |
| InChI | InChI=1S/C22H22N6O4S/c1-11-15-19(25-14-7-5-4-6-8-28(14)21(15)31)33-16(11)18(29)24-12-9-13-17(23-10-12)26(2)22(32)27(3)20(13)30/h9-10H,4-8H2,1-3H3,(H,24,29) |
| InChIKey | GLFLSFYVZPKDMV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |