C19H26N4OS — CID 24592299
5-methyl-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-4-propylthiophene-2-carboxamide (PubChem CID 24592299) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is 5-methyl-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-4-propylthiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-4-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 24592299 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 5-methyl-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-4-propylthiophene-2-carboxamide |
| SMILES | CCCc1cc(C(=O)Nc2ccc(N3CCN(C)CC3)nc2)sc1C |
| InChI | InChI=1S/C19H26N4OS/c1-4-5-15-12-17(25-14(15)2)19(24)21-16-6-7-18(20-13-16)23-10-8-22(3)9-11-23/h6-7,12-13H,4-5,8-11H2,1-3H3,(H,21,24) |
| InChIKey | HQCLRDSXSOKIQX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |