C18H13Cl2N5O2S3 — CID 24593522
N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide (PubChem CID 24593522) has the molecular formula C18H13Cl2N5O2S3 and a molecular weight of 498.44 g/mol. Its IUPAC name is N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide.
| Compound Name | N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide |
|---|---|
| PubChem CID | 24593522 |
| Molecular Formula | C18H13Cl2N5O2S3 |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 496.96 |
| IUPAC Name | N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide |
| SMILES | O=C(CCn1cnc2sccc2c1=O)Nc1nnc(SCc2c(Cl)cccc2Cl)s1 |
| InChI | InChI=1S/C18H13Cl2N5O2S3/c19-12-2-1-3-13(20)11(12)8-29-18-24-23-17(30-18)22-14(26)4-6-25-9-21-15-10(16(25)27)5-7-28-15/h1-3,5,7,9H,4,6,8H2,(H,22,23,26) |
| InChIKey | WKYAKASTTALMPF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|