C16H21N7O2S2 — CID 16882089
3-(1-tert-butyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 16882089) has the molecular formula C16H21N7O2S2 and a molecular weight of 407.53 g/mol. Its IUPAC name is 3-(1-tert-butyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(1-tert-butyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 16882089 |
| Molecular Formula | C16H21N7O2S2 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-(1-tert-butyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCSc1nnc(NC(=O)CCn2cnc3c(cnn3C(C)(C)C)c2=O)s1 |
| InChI | InChI=1S/C16H21N7O2S2/c1-5-26-15-21-20-14(27-15)19-11(24)6-7-22-9-17-12-10(13(22)25)8-18-23(12)16(2,3)4/h8-9H,5-7H2,1-4H3,(H,19,20,24) |
| InChIKey | VNZYKRWWSXKSHZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|