C25H29N3O4 — CID 24595021
[2-[[(1-methylimidazol-2-yl)-phenylmethyl]amino]-2-oxoethyl] 4-pentoxybenzoate (PubChem CID 24595021) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is [2-[[(1-methylimidazol-2-yl)-phenylmethyl]amino]-2-oxoethyl] 4-pentoxybenzoate.
| Compound Name | [2-[[(1-methylimidazol-2-yl)-phenylmethyl]amino]-2-oxoethyl] 4-pentoxybenzoate |
|---|---|
| PubChem CID | 24595021 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | [2-[[(1-methylimidazol-2-yl)-phenylmethyl]amino]-2-oxoethyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)OCC(=O)NC(c2ccccc2)c2nccn2C)cc1 |
| InChI | InChI=1S/C25H29N3O4/c1-3-4-8-17-31-21-13-11-20(12-14-21)25(30)32-18-22(29)27-23(19-9-6-5-7-10-19)24-26-15-16-28(24)2/h5-7,9-16,23H,3-4,8,17-18H2,1-2H3,(H,27,29) |
| InChIKey | ZSJUVXQHIPRPAL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|