C25H19F2N3O — CID 24597937
N-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]-4-(2-phenylethynyl)benzamide (PubChem CID 24597937) has the molecular formula C25H19F2N3O and a molecular weight of 415.44 g/mol. Its IUPAC name is N-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]-4-(2-phenylethynyl)benzamide.
| Compound Name | N-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 24597937 |
| Molecular Formula | C25H19F2N3O |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]-4-(2-phenylethynyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(C#Cc2ccccc2)cc1)c1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C25H19F2N3O/c1-17(23-29-21-9-5-6-10-22(21)30(23)25(26)27)28-24(31)20-15-13-19(14-16-20)12-11-18-7-3-2-4-8-18/h2-10,13-17,25H,1H3,(H,28,31) |
| InChIKey | JTTWTVNPFSUXNN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|