C27H25N5O2S — CID 24599797
N-[2-(1H-indol-3-yl)-2-phenylethyl]-2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide (PubChem CID 24599797) has the molecular formula C27H25N5O2S and a molecular weight of 483.60 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-2-phenylethyl]-2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide.
| Compound Name | N-[2-(1H-indol-3-yl)-2-phenylethyl]-2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 24599797 |
| Molecular Formula | C27H25N5O2S |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-2-phenylethyl]-2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
| SMILES | COc1ccc(-c2n[nH]c(=S)n2CC(=O)NCC(c2ccccc2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H25N5O2S/c1-34-20-13-11-19(12-14-20)26-30-31-27(35)32(26)17-25(33)29-15-22(18-7-3-2-4-8-18)23-16-28-24-10-6-5-9-21(23)24/h2-14,16,22,28H,15,17H2,1H3,(H,29,33)(H,31,35) |
| InChIKey | JVFNYTQZXLHSFX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 87.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|