C22H24N4OS — CID 24602411
N-benzyl-2-[(5-cyclopentyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-phenylacetamide (PubChem CID 24602411) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is N-benzyl-2-[(5-cyclopentyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-phenylacetamide.
| Compound Name | N-benzyl-2-[(5-cyclopentyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 24602411 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-benzyl-2-[(5-cyclopentyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-phenylacetamide |
| SMILES | O=C(CSc1n[nH]c(C2CCCC2)n1)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24N4OS/c27-20(16-28-22-23-21(24-25-22)18-11-7-8-12-18)26(19-13-5-2-6-14-19)15-17-9-3-1-4-10-17/h1-6,9-10,13-14,18H,7-8,11-12,15-16H2,(H,23,24,25) |
| InChIKey | CMEPFJYKYREGDS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |