C15H11F3N4O2S2 — CID 24602811
2,3,4-trifluoro-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]benzenesulfonamide (PubChem CID 24602811) has the molecular formula C15H11F3N4O2S2 and a molecular weight of 400.41 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24602811 |
| Molecular Formula | C15H11F3N4O2S2 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]benzenesulfonamide |
| SMILES | Cn1cnnc1Sc1ccccc1NS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H11F3N4O2S2/c1-22-8-19-20-15(22)25-11-5-3-2-4-10(11)21-26(23,24)12-7-6-9(16)13(17)14(12)18/h2-8,21H,1H3 |
| InChIKey | YWOVVVVRMOJSFZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|