C16H17ClN2O5S2 — CID 24602965
methyl 3-[(3-chloro-2-morpholin-4-ylphenyl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 24602965) has the molecular formula C16H17ClN2O5S2 and a molecular weight of 416.91 g/mol. Its IUPAC name is methyl 3-[(3-chloro-2-morpholin-4-ylphenyl)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(3-chloro-2-morpholin-4-ylphenyl)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 24602965 |
| Molecular Formula | C16H17ClN2O5S2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | methyl 3-[(3-chloro-2-morpholin-4-ylphenyl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)Nc1cccc(Cl)c1N1CCOCC1 |
| InChI | InChI=1S/C16H17ClN2O5S2/c1-23-16(20)15-13(5-10-25-15)26(21,22)18-12-4-2-3-11(17)14(12)19-6-8-24-9-7-19/h2-5,10,18H,6-9H2,1H3 |
| InChIKey | VDODIWATYWWRTF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |