C22H26N4OS — CID 2460364
10-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 2460364) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is 10-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 2460364 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 10-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | Cc1cccc(N2CCN(Cc3nc4sc5c(c4c(=O)[nH]3)CCC5)CC2)c1C |
| InChI | InChI=1S/C22H26N4OS/c1-14-5-3-7-17(15(14)2)26-11-9-25(10-12-26)13-19-23-21(27)20-16-6-4-8-18(16)28-22(20)24-19/h3,5,7H,4,6,8-13H2,1-2H3,(H,23,24,27) |
| InChIKey | BJVRENGYTILJFP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |