C23H26N6OS2 — CID 2464198
2-[[4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2464198) has the molecular formula C23H26N6OS2 and a molecular weight of 466.64 g/mol. Its IUPAC name is 2-[[4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2464198 |
| Molecular Formula | C23H26N6OS2 |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-[[4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2ncnc(N3CCN(Cc4nc5sc6c(c5c(=O)[nH]4)CCCC6)CC3)c2c1C |
| InChI | InChI=1S/C23H26N6OS2/c1-13-14(2)31-22-18(13)20(24-12-25-22)29-9-7-28(8-10-29)11-17-26-21(30)19-15-5-3-4-6-16(15)32-23(19)27-17/h12H,3-11H2,1-2H3,(H,26,27,30) |
| InChIKey | IKRXIDWHQKPMSE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |