C15H15F3N4O4 — CID 24608682
8-[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 24608682) has the molecular formula C15H15F3N4O4 and a molecular weight of 372.30 g/mol. Its IUPAC name is 8-[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 24608682 |
| Molecular Formula | C15H15F3N4O4 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 8-[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)c3ccc(OCC(F)(F)F)nc3)CC2)N1 |
| InChI | InChI=1S/C15H15F3N4O4/c16-15(17,18)8-26-10-2-1-9(7-19-10)11(23)22-5-3-14(4-6-22)12(24)20-13(25)21-14/h1-2,7H,3-6,8H2,(H2,20,21,24,25) |
| InChIKey | MKVWOEDNEFPKTD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|