C21H27N3O4S2 — CID 24611592
N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-4-ethyl-5-methylthiophene-2-carboxamide (PubChem CID 24611592) has the molecular formula C21H27N3O4S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-4-ethyl-5-methylthiophene-2-carboxamide.
| Compound Name | N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-4-ethyl-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 24611592 |
| Molecular Formula | C21H27N3O4S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[1-(4-acetamidophenyl)sulfonylpiperidin-4-yl]-4-ethyl-5-methylthiophene-2-carboxamide |
| SMILES | CCc1cc(C(=O)NC2CCN(S(=O)(=O)c3ccc(NC(C)=O)cc3)CC2)sc1C |
| InChI | InChI=1S/C21H27N3O4S2/c1-4-16-13-20(29-14(16)2)21(26)23-18-9-11-24(12-10-18)30(27,28)19-7-5-17(6-8-19)22-15(3)25/h5-8,13,18H,4,9-12H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | ZAEALGPABTVKDG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |