C19H23N3O4S2 — CID 24609619
5-acetamido-N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]thiophene-2-carboxamide (PubChem CID 24609619) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is 5-acetamido-N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-acetamido-N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24609619 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 5-acetamido-N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]thiophene-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NC2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 |
| InChI | InChI=1S/C19H23N3O4S2/c1-13-3-5-16(6-4-13)28(25,26)22-11-9-15(10-12-22)21-19(24)17-7-8-18(27-17)20-14(2)23/h3-8,15H,9-12H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | GJMHGDYHDRUHEV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |