C22H25N3O4S — CID 24612073
1-[(6-methoxynaphthalen-2-yl)methyl]-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]urea (PubChem CID 24612073) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is 1-[(6-methoxynaphthalen-2-yl)methyl]-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]urea.
| Compound Name | 1-[(6-methoxynaphthalen-2-yl)methyl]-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 24612073 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1-[(6-methoxynaphthalen-2-yl)methyl]-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]urea |
| SMILES | CNS(=O)(=O)Cc1ccc(CNC(=O)NCc2ccc3cc(OC)ccc3c2)cc1 |
| InChI | InChI=1S/C22H25N3O4S/c1-23-30(27,28)15-17-5-3-16(4-6-17)13-24-22(26)25-14-18-7-8-20-12-21(29-2)10-9-19(20)11-18/h3-12,23H,13-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | JVTPAPXXGDSNKF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |