C21H26N4O5S — CID 24612547
N-[4-[4-[(2-methoxyphenyl)carbamoylamino]piperidin-1-yl]sulfonylphenyl]acetamide (PubChem CID 24612547) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[4-[4-[(2-methoxyphenyl)carbamoylamino]piperidin-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[4-[(2-methoxyphenyl)carbamoylamino]piperidin-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 24612547 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-[4-[4-[(2-methoxyphenyl)carbamoylamino]piperidin-1-yl]sulfonylphenyl]acetamide |
| SMILES | COc1ccccc1NC(=O)NC1CCN(S(=O)(=O)c2ccc(NC(C)=O)cc2)CC1 |
| InChI | InChI=1S/C21H26N4O5S/c1-15(26)22-16-7-9-18(10-8-16)31(28,29)25-13-11-17(12-14-25)23-21(27)24-19-5-3-4-6-20(19)30-2/h3-10,17H,11-14H2,1-2H3,(H,22,26)(H2,23,24,27) |
| InChIKey | CGYWWSFEHWRTNC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |