C24H26N2O3 — CID 24613723
1-[4-[(E)-3-[2-(3-methoxyphenyl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]phenyl]pyrrolidin-2-one (PubChem CID 24613723) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-[4-[(E)-3-[2-(3-methoxyphenyl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[(E)-3-[2-(3-methoxyphenyl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 24613723 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-[4-[(E)-3-[2-(3-methoxyphenyl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]phenyl]pyrrolidin-2-one |
| SMILES | COc1cccc(C2CCCN2C(=O)/C=C/c2ccc(N3CCCC3=O)cc2)c1 |
| InChI | InChI=1S/C24H26N2O3/c1-29-21-6-2-5-19(17-21)22-7-3-16-26(22)24(28)14-11-18-9-12-20(13-10-18)25-15-4-8-23(25)27/h2,5-6,9-14,17,22H,3-4,7-8,15-16H2,1H3/b14-11+ |
| InChIKey | HPUVSWKYQXVYIT-SDNWHVSQSA-N |
| XLogP | 4.20 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|