C24H27N5O4S — CID 24614142
N-(5-carbamoyl-2-pyrrolidin-1-ylphenyl)-1-(4-cyanophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 24614142) has the molecular formula C24H27N5O4S and a molecular weight of 481.58 g/mol. Its IUPAC name is N-(5-carbamoyl-2-pyrrolidin-1-ylphenyl)-1-(4-cyanophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(5-carbamoyl-2-pyrrolidin-1-ylphenyl)-1-(4-cyanophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 24614142 |
| Molecular Formula | C24H27N5O4S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | N-(5-carbamoyl-2-pyrrolidin-1-ylphenyl)-1-(4-cyanophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCC(C(=O)Nc3cc(C(N)=O)ccc3N3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H27N5O4S/c25-16-17-3-6-20(7-4-17)34(32,33)29-13-9-18(10-14-29)24(31)27-21-15-19(23(26)30)5-8-22(21)28-11-1-2-12-28/h3-8,15,18H,1-2,9-14H2,(H2,26,30)(H,27,31) |
| InChIKey | AZASYQHNHJQUTR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 136.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |