C19H18BrNO3 — CID 24616218
6-bromo-N-[1-(2-methoxyphenyl)ethyl]-2H-chromene-3-carboxamide (PubChem CID 24616218) has the molecular formula C19H18BrNO3 and a molecular weight of 388.26 g/mol. Its IUPAC name is 6-bromo-N-[1-(2-methoxyphenyl)ethyl]-2H-chromene-3-carboxamide.
| Compound Name | 6-bromo-N-[1-(2-methoxyphenyl)ethyl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 24616218 |
| Molecular Formula | C19H18BrNO3 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 6-bromo-N-[1-(2-methoxyphenyl)ethyl]-2H-chromene-3-carboxamide |
| SMILES | COc1ccccc1C(C)NC(=O)C1=Cc2cc(Br)ccc2OC1 |
| InChI | InChI=1S/C19H18BrNO3/c1-12(16-5-3-4-6-18(16)23-2)21-19(22)14-9-13-10-15(20)7-8-17(13)24-11-14/h3-10,12H,11H2,1-2H3,(H,21,22) |
| InChIKey | VPMMVAQRNXTPAB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |