C22H17F3N2O3S — CID 24618639
N-[4-[[[(E)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoyl]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 24618639) has the molecular formula C22H17F3N2O3S and a molecular weight of 446.45 g/mol. Its IUPAC name is N-[4-[[[(E)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoyl]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[[(E)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoyl]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24618639 |
| Molecular Formula | C22H17F3N2O3S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-[4-[[[(E)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoyl]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(/C=C/c1ccc(SC(F)(F)F)cc1)NCc1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C22H17F3N2O3S/c23-22(24,25)31-18-10-5-15(6-11-18)7-12-20(28)26-14-16-3-8-17(9-4-16)27-21(29)19-2-1-13-30-19/h1-13H,14H2,(H,26,28)(H,27,29)/b12-7+ |
| InChIKey | FPICCTKMWMXPOR-KPKJPENVSA-N |
| XLogP | 5.47 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|