C21H21N5O2S2 — CID 24619105
2-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 24619105) has the molecular formula C21H21N5O2S2 and a molecular weight of 439.57 g/mol. Its IUPAC name is 2-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 24619105 |
| Molecular Formula | C21H21N5O2S2 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 2-[[4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)CSc3nncn3Cc3ccco3)n2)c(C)c1 |
| InChI | InChI=1S/C21H21N5O2S2/c1-13-7-14(2)19(15(3)8-13)17-10-29-20(23-17)24-18(27)11-30-21-25-22-12-26(21)9-16-5-4-6-28-16/h4-8,10,12H,9,11H2,1-3H3,(H,23,24,27) |
| InChIKey | RFXKIIYTQZFYHE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |