C16H10N2O4S2 — CID 24619230
(5Z)-3-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 24619230) has the molecular formula C16H10N2O4S2 and a molecular weight of 358.40 g/mol. Its IUPAC name is (5Z)-3-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 24619230 |
| Molecular Formula | C16H10N2O4S2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | (5Z)-3-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cccs2)C(=O)N1Cc1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C16H10N2O4S2/c19-15-14(8-11-3-2-6-23-11)24-16(20)18(15)9-10-7-13(22-17-10)12-4-1-5-21-12/h1-8H,9H2/b14-8- |
| InChIKey | RURNFNADJRYWSP-ZSOIEALJSA-N |
| XLogP | 4.23 |
| TPSA | 76.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|