C14H15N5O2S2 — CID 18145348
(5Z)-3-[(1-butyltetrazol-5-yl)methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 18145348) has the molecular formula C14H15N5O2S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is (5Z)-3-[(1-butyltetrazol-5-yl)methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(1-butyltetrazol-5-yl)methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18145348 |
| Molecular Formula | C14H15N5O2S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (5Z)-3-[(1-butyltetrazol-5-yl)methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCn1nnnc1CN1C(=O)S/C(=C\c2cccs2)C1=O |
| InChI | InChI=1S/C14H15N5O2S2/c1-2-3-6-19-12(15-16-17-19)9-18-13(20)11(23-14(18)21)8-10-5-4-7-22-10/h4-5,7-8H,2-3,6,9H2,1H3/b11-8- |
| InChIKey | RERYSAYITJOOLU-FLIBITNWSA-N |
| XLogP | 2.77 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|