C15H14N2O2S3 — CID 38877084
(5Z)-3-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 38877084) has the molecular formula C15H14N2O2S3 and a molecular weight of 350.49 g/mol. Its IUPAC name is (5Z)-3-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 38877084 |
| Molecular Formula | C15H14N2O2S3 |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | (5Z)-3-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)c1nc(CN2C(=O)S/C(=C\c3cccs3)C2=O)cs1 |
| InChI | InChI=1S/C15H14N2O2S3/c1-9(2)13-16-10(8-21-13)7-17-14(18)12(22-15(17)19)6-11-4-3-5-20-11/h3-6,8-9H,7H2,1-2H3/b12-6- |
| InChIKey | RISAHTJGYRLLLR-SDQBBNPISA-N |
| XLogP | 4.56 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|