C11H14N4O3S — CID 24620958
methyl 2-[(1-propan-2-yltetrazol-5-yl)sulfanylmethyl]furan-3-carboxylate (PubChem CID 24620958) has the molecular formula C11H14N4O3S and a molecular weight of 282.33 g/mol. Its IUPAC name is methyl 2-[(1-propan-2-yltetrazol-5-yl)sulfanylmethyl]furan-3-carboxylate.
| Compound Name | methyl 2-[(1-propan-2-yltetrazol-5-yl)sulfanylmethyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 24620958 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | methyl 2-[(1-propan-2-yltetrazol-5-yl)sulfanylmethyl]furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1CSc1nnnn1C(C)C |
| InChI | InChI=1S/C11H14N4O3S/c1-7(2)15-11(12-13-14-15)19-6-9-8(4-5-18-9)10(16)17-3/h4-5,7H,6H2,1-3H3 |
| InChIKey | OZVKOHSGBDOYHN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |