C14H14N4O3S2 — CID 24620960
methyl 2-[[1-(2-thiophen-2-ylethyl)tetrazol-5-yl]sulfanylmethyl]furan-3-carboxylate (PubChem CID 24620960) has the molecular formula C14H14N4O3S2 and a molecular weight of 350.43 g/mol. Its IUPAC name is methyl 2-[[1-(2-thiophen-2-ylethyl)tetrazol-5-yl]sulfanylmethyl]furan-3-carboxylate.
| Compound Name | methyl 2-[[1-(2-thiophen-2-ylethyl)tetrazol-5-yl]sulfanylmethyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 24620960 |
| Molecular Formula | C14H14N4O3S2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | methyl 2-[[1-(2-thiophen-2-ylethyl)tetrazol-5-yl]sulfanylmethyl]furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1CSc1nnnn1CCc1cccs1 |
| InChI | InChI=1S/C14H14N4O3S2/c1-20-13(19)11-5-7-21-12(11)9-23-14-15-16-17-18(14)6-4-10-3-2-8-22-10/h2-3,5,7-8H,4,6,9H2,1H3 |
| InChIKey | OIJTUALKDXYWGY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |