C11H15N5OS2 — CID 655852
2-(1-propyltetrazol-5-yl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 655852) has the molecular formula C11H15N5OS2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 2-(1-propyltetrazol-5-yl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(1-propyltetrazol-5-yl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 655852 |
| Molecular Formula | C11H15N5OS2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-(1-propyltetrazol-5-yl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCCn1nnnc1SCC(=O)NCc1cccs1 |
| InChI | InChI=1S/C11H15N5OS2/c1-2-5-16-11(13-14-15-16)19-8-10(17)12-7-9-4-3-6-18-9/h3-4,6H,2,5,7-8H2,1H3,(H,12,17) |
| InChIKey | BOSZIDCYBSSWDV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |