C18H18ClNO3 — CID 2462278
(4-chlorophenyl)methyl 3-(2-methylpropanoylamino)benzoate (PubChem CID 2462278) has the molecular formula C18H18ClNO3 and a molecular weight of 331.80 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 3-(2-methylpropanoylamino)benzoate.
| Compound Name | (4-chlorophenyl)methyl 3-(2-methylpropanoylamino)benzoate |
|---|---|
| PubChem CID | 2462278 |
| Molecular Formula | C18H18ClNO3 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (4-chlorophenyl)methyl 3-(2-methylpropanoylamino)benzoate |
| SMILES | CC(C)C(=O)Nc1cccc(C(=O)OCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H18ClNO3/c1-12(2)17(21)20-16-5-3-4-14(10-16)18(22)23-11-13-6-8-15(19)9-7-13/h3-10,12H,11H2,1-2H3,(H,20,21) |
| InChIKey | KIXDHJUWOJJZEJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |