C19H21N5OS — CID 24623746
N-phenyl-2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidin-1-yl]acetamide (PubChem CID 24623746) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is N-phenyl-2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidin-1-yl]acetamide.
| Compound Name | N-phenyl-2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 24623746 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-phenyl-2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(Nc2ncnc3ccsc23)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C19H21N5OS/c25-17(22-14-4-2-1-3-5-14)12-24-9-6-15(7-10-24)23-19-18-16(8-11-26-18)20-13-21-19/h1-5,8,11,13,15H,6-7,9-10,12H2,(H,22,25)(H,20,21,23) |
| InChIKey | JHDSIKAPIXCSSH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |