C20H17N3O2S — CID 2462466
N-(2,5-dimethoxyphenyl)-6-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 2462466) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-6-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2,5-dimethoxyphenyl)-6-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 2462466 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-6-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(OC)c(Nc2ncnc3sc(-c4ccccc4)cc23)c1 |
| InChI | InChI=1S/C20H17N3O2S/c1-24-14-8-9-17(25-2)16(10-14)23-19-15-11-18(13-6-4-3-5-7-13)26-20(15)22-12-21-19/h3-12H,1-2H3,(H,21,22,23) |
| InChIKey | IRSIUYXIFQTDMD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |