C19H22N4O4 — CID 24626903
1-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-1-methyl-3-(3-nitrophenyl)urea (PubChem CID 24626903) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-1-methyl-3-(3-nitrophenyl)urea.
| Compound Name | 1-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-1-methyl-3-(3-nitrophenyl)urea |
|---|---|
| PubChem CID | 24626903 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-1-methyl-3-(3-nitrophenyl)urea |
| SMILES | CCN1CC(CN(C)C(=O)Nc2cccc([N+](=O)[O-])c2)Oc2ccccc21 |
| InChI | InChI=1S/C19H22N4O4/c1-3-22-13-16(27-18-10-5-4-9-17(18)22)12-21(2)19(24)20-14-7-6-8-15(11-14)23(25)26/h4-11,16H,3,12-13H2,1-2H3,(H,20,24) |
| InChIKey | QFIDYDFALZCXEW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|