C24H25N3O2S — CID 24628498
2-(2,5-dimethylphenyl)sulfanyl-N-(4-morpholin-4-ylphenyl)pyridine-3-carboxamide (PubChem CID 24628498) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)sulfanyl-N-(4-morpholin-4-ylphenyl)pyridine-3-carboxamide.
| Compound Name | 2-(2,5-dimethylphenyl)sulfanyl-N-(4-morpholin-4-ylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24628498 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-(2,5-dimethylphenyl)sulfanyl-N-(4-morpholin-4-ylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(C)c(Sc2ncccc2C(=O)Nc2ccc(N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C24H25N3O2S/c1-17-5-6-18(2)22(16-17)30-24-21(4-3-11-25-24)23(28)26-19-7-9-20(10-8-19)27-12-14-29-15-13-27/h3-11,16H,12-15H2,1-2H3,(H,26,28) |
| InChIKey | CEAAPYDDSCEUES-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|