C21H27N5OS2 — CID 24630275
2-[1-[[5-(cyclopentylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 24630275) has the molecular formula C21H27N5OS2 and a molecular weight of 429.62 g/mol. Its IUPAC name is 2-[1-[[5-(cyclopentylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[1-[[5-(cyclopentylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24630275 |
| Molecular Formula | C21H27N5OS2 |
| Molecular Weight | 429.62 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 2-[1-[[5-(cyclopentylmethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC1CCc2c(sc3nc(C(C)Sc4n[nH]c(CC5CCCC5)n4)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C21H27N5OS2/c1-11-7-8-14-15(9-11)29-20-17(14)19(27)23-18(24-20)12(2)28-21-22-16(25-26-21)10-13-5-3-4-6-13/h11-13H,3-10H2,1-2H3,(H,22,25,26)(H,23,24,27) |
| InChIKey | NLCGQUXADSBJLQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.62 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |