C18H23N5OS2 — CID 7587868
(7S)-7-methyl-2-[(1S)-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7587868) has the molecular formula C18H23N5OS2 and a molecular weight of 389.55 g/mol. Its IUPAC name is (7S)-7-methyl-2-[(1S)-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7S)-7-methyl-2-[(1S)-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7587868 |
| Molecular Formula | C18H23N5OS2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (7S)-7-methyl-2-[(1S)-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC(C)n1cnnc1S[C@@H](C)c1nc2sc3c(c2c(=O)[nH]1)CC[C@H](C)C3 |
| InChI | InChI=1S/C18H23N5OS2/c1-9(2)23-8-19-22-18(23)25-11(4)15-20-16(24)14-12-6-5-10(3)7-13(12)26-17(14)21-15/h8-11H,5-7H2,1-4H3,(H,20,21,24)/t10-,11-/m0/s1 |
| InChIKey | KZRGMJLEAQKMOI-QWRGUYRKSA-N |
| XLogP | 4.14 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |