C18H22N6OS2 — CID 9141967
(7R)-2-[(1S)-1-[(4-amino-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 9141967) has the molecular formula C18H22N6OS2 and a molecular weight of 402.55 g/mol. Its IUPAC name is (7R)-2-[(1S)-1-[(4-amino-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7R)-2-[(1S)-1-[(4-amino-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 9141967 |
| Molecular Formula | C18H22N6OS2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (7R)-2-[(1S)-1-[(4-amino-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C[C@@H]1CCc2c(sc3nc([C@H](C)Sc4nnc(C5CC5)n4N)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C18H22N6OS2/c1-8-3-6-11-12(7-8)27-17-13(11)16(25)20-14(21-17)9(2)26-18-23-22-15(24(18)19)10-4-5-10/h8-10H,3-7,19H2,1-2H3,(H,20,21,25)/t8-,9+/m1/s1 |
| InChIKey | ZTAGYXXDELKQFQ-BDAKNGLRSA-N |
| XLogP | 3.15 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |