About methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate
methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate (PubChem CID 24632476) has the molecular formula C14H11F3N2O4S
and a molecular weight of 360.31 g/mol. Its IUPAC name is methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate |
| PubChem CID | 24632476 |
| Molecular Formula | C14H11F3N2O4S |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc(OCC(F)(F)F)nc2)s1 |
| InChI | InChI=1S/C14H11F3N2O4S/c1-22-13(21)9-3-5-11(24-9)19-12(20)8-2-4-10(18-6-8)23-7-14(15,16)17/h2-6H,7H2,1H3,(H,19,20) |
| InChIKey | KZETXITYAZNHFY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate?
The IUPAC name of methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate (CID 24632476) is methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate?
The canonical SMILES for methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate is COC(=O)c1ccc(NC(=O)c2ccc(OCC(F)(F)F)nc2)s1.
What is the InChIKey of methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate?
The InChIKey is KZETXITYAZNHFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F3N2O4S/c1-22-13(21)9-3-5-11(24-9)19-12(20)8-2-4-10(18-6-8)23-7-14(15,16)17/h2-6H,7H2,1H3,(H,19,20).
What are the key properties of methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate?
methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate has a molecular weight of 360.31 g/mol, XLogP of 3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]amino]thiophene-2-carboxylate is sourced from PubChem (CID 24632476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).