C22H24N2O4S — CID 24634646
N'-[2-(2,3-dimethylphenoxy)propanoyl]-3-(methylsulfanylmethyl)-1-benzofuran-2-carbohydrazide (PubChem CID 24634646) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is N'-[2-(2,3-dimethylphenoxy)propanoyl]-3-(methylsulfanylmethyl)-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-3-(methylsulfanylmethyl)-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 24634646 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-3-(methylsulfanylmethyl)-1-benzofuran-2-carbohydrazide |
| SMILES | CSCc1c(C(=O)NNC(=O)C(C)Oc2cccc(C)c2C)oc2ccccc12 |
| InChI | InChI=1S/C22H24N2O4S/c1-13-8-7-11-18(14(13)2)27-15(3)21(25)23-24-22(26)20-17(12-29-4)16-9-5-6-10-19(16)28-20/h5-11,15H,12H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | IXCPMTQUOJZXTD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|