About 4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide
4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 2463677) has the molecular formula C12H13N3OS
and a molecular weight of 247.32 g/mol. Its IUPAC name is 4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 2463677 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CN(C)c1ccc(C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C12H13N3OS/c1-15(2)10-5-3-9(4-6-10)11(16)14-12-13-7-8-17-12/h3-8H,1-2H3,(H,13,14,16) |
| InChIKey | RGXFQNTVZRGDNG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide (CID 2463677) is 4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide is CN(C)c1ccc(C(=O)Nc2nccs2)cc1.
What is the InChIKey of 4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide?
The InChIKey is RGXFQNTVZRGDNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3OS/c1-15(2)10-5-3-9(4-6-10)11(16)14-12-13-7-8-17-12/h3-8H,1-2H3,(H,13,14,16).
What are the key properties of 4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide?
4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide has a molecular weight of 247.32 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-N-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 2463677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).