C18H27ClN4O4S — CID 24641891
N-tert-butyl-2-[4-[4-chloro-3-(methylsulfamoyl)benzoyl]piperazin-1-yl]acetamide (PubChem CID 24641891) has the molecular formula C18H27ClN4O4S and a molecular weight of 430.96 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[4-chloro-3-(methylsulfamoyl)benzoyl]piperazin-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[4-chloro-3-(methylsulfamoyl)benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 24641891 |
| Molecular Formula | C18H27ClN4O4S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-tert-butyl-2-[4-[4-chloro-3-(methylsulfamoyl)benzoyl]piperazin-1-yl]acetamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N2CCN(CC(=O)NC(C)(C)C)CC2)ccc1Cl |
| InChI | InChI=1S/C18H27ClN4O4S/c1-18(2,3)21-16(24)12-22-7-9-23(10-8-22)17(25)13-5-6-14(19)15(11-13)28(26,27)20-4/h5-6,11,20H,7-10,12H2,1-4H3,(H,21,24) |
| InChIKey | XFHRKZOVXAEKDL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |