C23H30N6OS — CID 24643554
2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]acetamide (PubChem CID 24643554) has the molecular formula C23H30N6OS and a molecular weight of 438.60 g/mol. Its IUPAC name is 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]acetamide.
| Compound Name | 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 24643554 |
| Molecular Formula | C23H30N6OS |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
| SMILES | CSc1nc2nc(C)c(CC(=O)N(C)Cc3ccc(N4CCCCC4)cc3)c(C)n2n1 |
| InChI | InChI=1S/C23H30N6OS/c1-16-20(17(2)29-22(24-16)25-23(26-29)31-4)14-21(30)27(3)15-18-8-10-19(11-9-18)28-12-6-5-7-13-28/h8-11H,5-7,12-15H2,1-4H3 |
| InChIKey | UEJJTZALYBSFJX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|