C22H28N6O2S — CID 26788092
2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-methyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]acetamide (PubChem CID 26788092) has the molecular formula C22H28N6O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-methyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]acetamide.
| Compound Name | 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-methyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 26788092 |
| Molecular Formula | C22H28N6O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-methyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]acetamide |
| SMILES | CSc1nc2nc(C)c(CC(=O)N(C)CC(=O)Nc3c(C)cc(C)cc3C)c(C)n2n1 |
| InChI | InChI=1S/C22H28N6O2S/c1-12-8-13(2)20(14(3)9-12)24-18(29)11-27(6)19(30)10-17-15(4)23-21-25-22(31-7)26-28(21)16(17)5/h8-9H,10-11H2,1-7H3,(H,24,29) |
| InChIKey | IGPRQWKRKVJZPO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |