C21H24FN3O6S2 — CID 24644512
1-(2-fluorophenyl)sulfonyl-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)pyrrolidine-2-carboxamide (PubChem CID 24644512) has the molecular formula C21H24FN3O6S2 and a molecular weight of 497.57 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfonyl-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-fluorophenyl)sulfonyl-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24644512 |
| Molecular Formula | C21H24FN3O6S2 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 1-(2-fluorophenyl)sulfonyl-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCCC2)ccc1O)C1CCCN1S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C21H24FN3O6S2/c22-16-6-1-2-8-20(16)33(30,31)25-13-5-7-18(25)21(27)23-17-14-15(9-10-19(17)26)32(28,29)24-11-3-4-12-24/h1-2,6,8-10,14,18,26H,3-5,7,11-13H2,(H,23,27) |
| InChIKey | YJSABVMBAOMAMM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|