C16H17NO6 — CID 2464845
[2-[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]-2-oxoethyl] 3-methylbut-2-enoate (PubChem CID 2464845) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is [2-[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]-2-oxoethyl] 3-methylbut-2-enoate.
| Compound Name | [2-[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]-2-oxoethyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 2464845 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [2-[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]-2-oxoethyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCC(=O)NC(=O)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C16H17NO6/c1-10(2)7-15(19)22-9-14(18)17-16(20)13-8-21-11-5-3-4-6-12(11)23-13/h3-7,13H,8-9H2,1-2H3,(H,17,18,20)/t13-/m1/s1 |
| InChIKey | RRZKEHCQVNHBNY-CYBMUJFWSA-N |
| XLogP | 0.98 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|