C20H16N2O8 — CID 2423250
[2-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]-2-oxoethyl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 2423250) has the molecular formula C20H16N2O8 and a molecular weight of 412.35 g/mol. Its IUPAC name is [2-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]-2-oxoethyl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]-2-oxoethyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2423250 |
| Molecular Formula | C20H16N2O8 |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [2-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]amino]-2-oxoethyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc([N+](=O)[O-])cc1)NC(=O)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C20H16N2O8/c23-18(21-20(25)17-11-28-15-3-1-2-4-16(15)30-17)12-29-19(24)10-7-13-5-8-14(9-6-13)22(26)27/h1-10,17H,11-12H2,(H,21,23,25)/b10-7+/t17-/m0/s1 |
| InChIKey | PNPPECQNVVTFDQ-JEJOPICUSA-N |
| XLogP | 1.63 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|