C15H18N4O3 — CID 24650166
2-(4-nitroimidazol-1-yl)-N-(1-phenylbutyl)acetamide (PubChem CID 24650166) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-(4-nitroimidazol-1-yl)-N-(1-phenylbutyl)acetamide.
| Compound Name | 2-(4-nitroimidazol-1-yl)-N-(1-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 24650166 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-(4-nitroimidazol-1-yl)-N-(1-phenylbutyl)acetamide |
| SMILES | CCCC(NC(=O)Cn1cnc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C15H18N4O3/c1-2-6-13(12-7-4-3-5-8-12)17-15(20)10-18-9-14(16-11-18)19(21)22/h3-5,7-9,11,13H,2,6,10H2,1H3,(H,17,20) |
| InChIKey | IQNKEILKJSLWIS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|