C14H15N5O4 — CID 24650226
N-[(3,4-dimethylphenyl)carbamoyl]-2-(4-nitroimidazol-1-yl)acetamide (PubChem CID 24650226) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)carbamoyl]-2-(4-nitroimidazol-1-yl)acetamide.
| Compound Name | N-[(3,4-dimethylphenyl)carbamoyl]-2-(4-nitroimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 24650226 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-[(3,4-dimethylphenyl)carbamoyl]-2-(4-nitroimidazol-1-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)NC(=O)Cn2cnc([N+](=O)[O-])c2)cc1C |
| InChI | InChI=1S/C14H15N5O4/c1-9-3-4-11(5-10(9)2)16-14(21)17-13(20)7-18-6-12(15-8-18)19(22)23/h3-6,8H,7H2,1-2H3,(H2,16,17,20,21) |
| InChIKey | AEXGIKJPHNBQCV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|