C9H9N5O3S — CID 33356859
N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitroimidazol-1-yl)acetamide (PubChem CID 33356859) has the molecular formula C9H9N5O3S and a molecular weight of 267.27 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitroimidazol-1-yl)acetamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitroimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 33356859 |
| Molecular Formula | C9H9N5O3S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitroimidazol-1-yl)acetamide |
| SMILES | Cc1csc(NC(=O)Cn2cnc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C9H9N5O3S/c1-6-4-18-9(11-6)12-8(15)3-13-2-7(10-5-13)14(16)17/h2,4-5H,3H2,1H3,(H,11,12,15) |
| InChIKey | KNDFPHFFYPDUPC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|