C22H28N4O3S2 — CID 24651666
2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-(oxolan-2-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 24651666) has the molecular formula C22H28N4O3S2 and a molecular weight of 460.63 g/mol. Its IUPAC name is 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-(oxolan-2-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-(oxolan-2-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24651666 |
| Molecular Formula | C22H28N4O3S2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-(oxolan-2-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCCc1noc(CSc2nc3sc4c(c3c(=O)n2CC2CCCO2)CCCC4)n1 |
| InChI | InChI=1S/C22H28N4O3S2/c1-2-3-10-17-23-18(29-25-17)13-30-22-24-20-19(15-8-4-5-9-16(15)31-20)21(27)26(22)12-14-7-6-11-28-14/h14H,2-13H2,1H3 |
| InChIKey | RHNDOEQSTUPAMR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |